CAS 1795283-40-7 appears in our catalog under these names: 3-(Aminomethyl)-2-fluorobenzonitrile hydrochloride, 3-(Aminomethyl)-2-fluorobenzonitrile hydrochloride, 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 10mg, 25mg, 100mg, 250mg.
3-(aminomethyl)-2-fluorobenzonitrile;hydrochloride (CAS 1795283-40-7) is a chemical compound with the molecular formula C8H8ClFN2 and a molecular weight of 186.61 g/mol. IUPAC name: 3-(aminomethyl)-2-fluorobenzonitrile;hydrochloride. InChIKey: MZIBDLXQHZOKHV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2 |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 3-(aminomethyl)-2-fluorobenzonitrile;hydrochloride |
| InChIKey | MZIBDLXQHZOKHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)F)CN.Cl |
Computed by PubChem (NCBI)