Products 1266231-62-2
CAS 1266231-62-2 is the registry number for tert-butyl (1S,3R,5S)-3-(hydroxymethyl)-2-azabicyclo(3.1.0)hexane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl (1S,3R,5S)-3-(hydroxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1266231-62-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,3R,5S)-3-(hydroxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: DBOGUJDUACLSTB-HLTSFMKQSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,3R,5S)-3-(hydroxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | DBOGUJDUACLSTB-HLTSFMKQSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C[C@H]2[C@@H]1C2)CO |
Computed by PubChem (NCBI)