Products 1266372-57-9
CAS 1266372-57-9 is the registry number for tert-Butyl 3-((tert-butyldimethylsilyl)oxy)-5-(hydroxymethyl)piperidine-1-carboxylate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)piperidine-1-carboxylate (CAS 1266372-57-9) is a chemical compound with the molecular formula C17H35NO4Si and a molecular weight of 345.5 g/mol. IUPAC name: tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: IPOAEDZEWFWWSI-UHFFFAOYSA-N.
| Molecular formula | C17H35NO4Si |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | IPOAEDZEWFWWSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)O[Si](C)(C)C(C)(C)C)CO |
Computed by PubChem (NCBI)