CAS 2865073-15-8 is the registry number for tert-butyl (3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-azepane-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyazepane-1-carboxylate (CAS 2865073-15-8) is a chemical compound with the molecular formula C17H35NO4Si and a molecular weight of 345.5 g/mol. IUPAC name: tert-butyl (3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyazepane-1-carboxylate. InChIKey: QXEQPECMYZBCBD-KBPBESRZSA-N.
| Molecular formula | C17H35NO4Si |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | tert-butyl (3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyazepane-1-carboxylate |
| InChIKey | QXEQPECMYZBCBD-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC[C@@H](C1)O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)