CAS 126641-61-0 appears in our catalog under these names: 3-Hydroxy-Desoxydihydro Artemisinin, 3-Hydroxy Deoxy Dihydro Artemisinin, >95% (HPLC), 3-Hydroxy deoxy dihydro artemisinin. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 25mg, 1mg, 5mg, 10mg, 50mg.
(1R,2R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane-2,10-diol (CAS 126641-61-0) is a chemical compound with the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. IUPAC name: (1R,2R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane-2,10-diol. InChIKey: HTYSVFNZNVQCLV-PBDCUWOQSA-N.
| Molecular formula | C15H24O5 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (1R,2R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane-2,10-diol |
| InChIKey | HTYSVFNZNVQCLV-PBDCUWOQSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C(O[C@H]3[C@@]24[C@H]1C[C@H]([C@@](O3)(O4)C)O)O)C |
Computed by PubChem (NCBI)