Products 198817-95-7
CAS 198817-95-7 appears in our catalog under these names: Dihydroartemisinin Tetrafurano Acetate, Dihydroartemisinin Impurity 2, Dihydro artemisinin tetrahydrofuran acetate. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(3aS,4R,6aS,7R,10R,10aR)-8-hydroxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate (CAS 198817-95-7) is a chemical compound with the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. IUPAC name: [(3aS,4R,6aS,7R,10R,10aR)-8-hydroxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate. InChIKey: MXTIBMLCXHSHGJ-AAAPMNIRSA-N.
| Molecular formula | C15H24O5 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | [(3aS,4R,6aS,7R,10R,10aR)-8-hydroxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate |
| InChIKey | MXTIBMLCXHSHGJ-AAAPMNIRSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C(O[C@@H]([C@@]23[C@H]1CCO3)OC(=O)C)O)C |
Computed by PubChem (NCBI)