CAS 126647-89-0 appears in our catalog under these names: Estriol Impurity 15, Equilin Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate (CAS 126647-89-0) is a chemical compound with the molecular formula C18H22O5S and a molecular weight of 350.4 g/mol. IUPAC name: [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate. InChIKey: IVPYDRYLQPJSBW-UBDQQSCGSA-N.
| Molecular formula | C18H22O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| InChIKey | IVPYDRYLQPJSBW-UBDQQSCGSA-N |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=C4)OS(=O)(=O)O)[C@@H]1CC[C@@H]2O |
Computed by PubChem (NCBI)