CAS 98627-22-6 appears in our catalog under these names: Benzyl-peg3-tos, 95%, Benzyl–PEG2–Tos, Benzyl-PEG2-Tos 95%, 2-(2-(Benzyloxy)ethoxy)ethyl 4-methylbenzenesulfonate, 98%, 98%, Benzyl-PEG2-Tos, 98.54%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 25mg, 50mg, 5g, 25g, 500 mg.
2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate (CAS 98627-22-6) is a chemical compound with the molecular formula C18H22O5S and a molecular weight of 350.4 g/mol. IUPAC name: 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate. InChIKey: NFEMXFVBUWGQRW-UHFFFAOYSA-N.
| Molecular formula | C18H22O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | NFEMXFVBUWGQRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)