Products 1266883-78-6
CAS 1266883-78-6 is the registry number for Cyclopropyl(2,3,4-trifluorophenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,3,4-trifluorophenyl)methanone (CAS 1266883-78-6) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: cyclopropyl-(2,3,4-trifluorophenyl)methanone. InChIKey: WRJWRNGJLXOXEO-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | cyclopropyl-(2,3,4-trifluorophenyl)methanone |
| InChIKey | WRJWRNGJLXOXEO-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C(=C(C=C2)F)F)F |
Computed by PubChem (NCBI)