Products 126724-95-6
CAS 126724-95-6 is the registry number for Tilifodiolide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 1 mg.
(1R,8S)-1-(furan-3-yl)-8-(5-oxo-2H-furan-4-yl)-6,7,8,9-tetrahydro-1H-benzo[e][2]benzofuran-3-one (CAS 126724-95-6) is a chemical compound with the molecular formula C20H16O5 and a molecular weight of 336.3 g/mol. IUPAC name: (1R,8S)-1-(furan-3-yl)-8-(5-oxo-2H-furan-4-yl)-6,7,8,9-tetrahydro-1H-benzo[e][2]benzofuran-3-one. InChIKey: GBTJKEKFEUNDHY-SGTLLEGYSA-N.
| Molecular formula | C20H16O5 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (1R,8S)-1-(furan-3-yl)-8-(5-oxo-2H-furan-4-yl)-6,7,8,9-tetrahydro-1H-benzo[e][2]benzofuran-3-one |
| InChIKey | GBTJKEKFEUNDHY-SGTLLEGYSA-N |
| SMILES | C1CC2=C(C[C@H]1C3=CCOC3=O)C4=C(C=C2)C(=O)O[C@H]4C5=COC=C5 |
Computed by PubChem (NCBI)