CAS 67122-26-3 is the registry number for 8-Acetyl-7,8,9,10-tetrahydro-6,11-dihydroxy-5,12-naphthacenedione. Offered by: TRC. Available pack sizes: 100mg.
8-acetyl-6,11-dihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione (CAS 67122-26-3) is a chemical compound with the molecular formula C20H16O5 and a molecular weight of 336.3 g/mol. IUPAC name: 8-acetyl-6,11-dihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione. InChIKey: HIIVCLZCYLLSFS-UHFFFAOYSA-N.
| Molecular formula | C20H16O5 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 8-acetyl-6,11-dihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| InChIKey | HIIVCLZCYLLSFS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CCC2=C(C1)C(=C3C(=C2O)C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)