CAS 1637310-45-2 is the registry number for Benzyl (2s)-2-methyl-3-oxo-2-(propan-2-yl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (2S)-2-methyl-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate (CAS 1637310-45-2) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: benzyl (2S)-2-methyl-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate. InChIKey: BUSQIQZFCPUUCO-INIZCTEOSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | benzyl (2S)-2-methyl-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate |
| InChIKey | BUSQIQZFCPUUCO-INIZCTEOSA-N |
| SMILES | CC(C)[C@]1(C(=O)CCN1C(=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)