CAS 1268015-38-8 is the registry number for NIOCH 14. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 25 mg, 5 mg.
7-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid (CAS 1268015-38-8) is a chemical compound with the molecular formula C19H17F3N2O4 and a molecular weight of 394.3 g/mol. IUPAC name: 7-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid. InChIKey: YDHJUPUAMAWEOT-UHFFFAOYSA-N.
| Molecular formula | C19H17F3N2O4 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 7-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| InChIKey | YDHJUPUAMAWEOT-UHFFFAOYSA-N |
| SMILES | C1C2C1C3C=CC2C(C3C(=O)O)C(=O)NNC(=O)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)