Products 252913-85-2
CAS 252913-85-2 appears in our catalog under these names: Trifloxystrobin Acid, >95% (HPLC), Trifloxystrobin (free acid), Trifloxystrobin (free acid) 100 µg/mL in Acetonitrile, Trifloxystrobin acid, TRIFLOXYSTROBIN METABOLITE CGA 321113. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 10mg, 50mg, 1ml, 25mg, 1x10mg.
(2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid (CAS 252913-85-2) is a chemical compound with the molecular formula C19H17F3N2O4 and a molecular weight of 394.3 g/mol. IUPAC name: (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid. InChIKey: ISZQNKFXNXQTTF-NACSPRHISA-N.
| Molecular formula | C19H17F3N2O4 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid |
| InChIKey | ISZQNKFXNXQTTF-NACSPRHISA-N |
| SMILES | C/C(=N\OCC1=CC=CC=C1/C(=N\OC)/C(=O)O)/C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)