CAS 1268036-59-4 appears in our catalog under these names: 2-Methyl-2-(2-(thiophen-2-yl)-1,3-thiazol-4-yl)propanoic acid, 95%, 2-Methyl-2-(2-(thiophen-2-yl)-1,3-thiazol-4-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-methyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanoic acid (CAS 1268036-59-4) is a chemical compound with the molecular formula C11H11NO2S2 and a molecular weight of 253.3 g/mol. IUPAC name: 2-methyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanoic acid. InChIKey: IUHPETLBCNHHMV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 2-methyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanoic acid |
| InChIKey | IUHPETLBCNHHMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CSC(=N1)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)