CAS 80357-74-0 appears in our catalog under these names: 4-(Benzothiazol-2-ylsulfanyl)-butyric acid, 95%, 4-(Benzo(d)thiazol-2-ylthio)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
4-(1,3-benzothiazol-2-ylsulfanyl)butanoic acid (CAS 80357-74-0) is a chemical compound with the molecular formula C11H11NO2S2 and a molecular weight of 253.3 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-ylsulfanyl)butanoic acid. InChIKey: VLBFSFGWNXSNRM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-ylsulfanyl)butanoic acid |
| InChIKey | VLBFSFGWNXSNRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCCCC(=O)O |
Computed by PubChem (NCBI)