Products 126840-22-0
CAS 126840-22-0 appears in our catalog under these names: n-Pentyl-d11 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-PENTAN-D11-OL, 98 ATOM % D. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 0,5g, 0,25g, 5G.
1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentan-1-ol (CAS 126840-22-0) is a chemical compound with the molecular formula C5H12O and a molecular weight of 99.22 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentan-1-ol. InChIKey: AMQJEAYHLZJPGS-GILSBCIXSA-N.
| Molecular formula | C5H12O |
|---|---|
| Molecular weight | 99.22 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentan-1-ol |
| InChIKey | AMQJEAYHLZJPGS-GILSBCIXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)