CAS 1268474-72-1 is the registry number for Ethyl (2S,3R)-2-methylmorpholine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3R)-2-methylmorpholine-3-carboxylate (CAS 1268474-72-1) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: ethyl (2S,3R)-2-methylmorpholine-3-carboxylate. InChIKey: JPPFRBDSMPJHKR-NKWVEPMBSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | ethyl (2S,3R)-2-methylmorpholine-3-carboxylate |
| InChIKey | JPPFRBDSMPJHKR-NKWVEPMBSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H](OCCN1)C |
Computed by PubChem (NCBI)