Products 1268515-22-5
CAS 1268515-22-5 is the registry number for Benzyl (1R)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (1R)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1268515-22-5) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl (1R)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: UFGWUTLIQUXXEX-TYZXPVIJSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl (1R)-1-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | UFGWUTLIQUXXEX-TYZXPVIJSA-N |
| SMILES | C1C2[C@]1(CN(C2)C(=O)OCC3=CC=CC=C3)CO |
Computed by PubChem (NCBI)