CAS 1268521-74-9 is the registry number for tert-Butyl 1-isopropyl-7-oxo-1,4,6,7-tetrahydrospiro[indazole-5,4'-piperidine]-1'-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 7-oxo-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-1'-carboxylate (CAS 1268521-74-9) is a chemical compound with the molecular formula C19H29N3O3 and a molecular weight of 347.5 g/mol. IUPAC name: tert-butyl 7-oxo-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-1'-carboxylate. InChIKey: JRQQDCDIUOWSDI-UHFFFAOYSA-N.
| Molecular formula | C19H29N3O3 |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | tert-butyl 7-oxo-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-1'-carboxylate |
| InChIKey | JRQQDCDIUOWSDI-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(CC3(CCN(CC3)C(=O)OC(C)(C)C)CC2=O)C=N1 |
Computed by PubChem (NCBI)