Products 1820613-83-9
CAS 1820613-83-9 is the registry number for 1'-(3-Isopropoxy-4-nitrophenyl)-1,4'-bipiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-nitro-3-propan-2-yloxyphenyl)-4-piperidin-1-ylpiperidine (CAS 1820613-83-9) is a chemical compound with the molecular formula C19H29N3O3 and a molecular weight of 347.5 g/mol. IUPAC name: 1-(4-nitro-3-propan-2-yloxyphenyl)-4-piperidin-1-ylpiperidine. InChIKey: CMHFWFAONXKWLF-UHFFFAOYSA-N.
| Molecular formula | C19H29N3O3 |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | 1-(4-nitro-3-propan-2-yloxyphenyl)-4-piperidin-1-ylpiperidine |
| InChIKey | CMHFWFAONXKWLF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)N2CCC(CC2)N3CCCCC3)[N+](=O)[O-] |
Computed by PubChem (NCBI)