Products 126865-31-4

CAS 126865-31-4 is the registry number for Methyl 5-amino-3-(2-hydroxyethoxy)-1,2-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-3-(2-hydroxyethoxy)-1,2-oxazole-4-carboxylate (CAS 126865-31-4) is a chemical compound with the molecular formula C7H10N2O5 and a molecular weight of 202.16 g/mol. IUPAC name: methyl 5-amino-3-(2-hydroxyethoxy)-1,2-oxazole-4-carboxylate. InChIKey: DYWQVBBUPAGWQP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O5
Molecular weight202.16 g/mol
IUPAC namemethyl 5-amino-3-(2-hydroxyethoxy)-1,2-oxazole-4-carboxylate
InChIKeyDYWQVBBUPAGWQP-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(ON=C1OCCO)N

Computed by PubChem (NCBI)