CAS 1820712-04-6 appears in our catalog under these names: 5-Carbethoxyuracil hydrate, 95%, Ethyl 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate hydrate, 97%, 5–Carbethoxyuracil Hydrate, 5-Carbethoxyuracil Hydrate, >97%, >97%, 5-CARBETHOXYURACIL HYDRATE, >97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg.
Ethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate (CAS 1820712-04-6) is a chemical compound with the molecular formula C7H10N2O5 and a molecular weight of 202.16 g/mol. IUPAC name: ethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate. InChIKey: XIELLLWKQHKAQA-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O5 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | ethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate |
| InChIKey | XIELLLWKQHKAQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=O)NC1=O.O |
Computed by PubChem (NCBI)