Products 1268819-26-6
CAS 1268819-26-6 is the registry number for 2,2'-((5-Bromothiophen-2-yl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-bromothiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 1268819-26-6) is a chemical compound with the molecular formula C13H11BrN2S and a molecular weight of 307.21 g/mol. IUPAC name: 2-[(5-bromothiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: IYEMESXJBWMNBC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2S |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 2-[(5-bromothiophen-2-yl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | IYEMESXJBWMNBC-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(C2=CC=CN2)C3=CC=C(S3)Br |
Computed by PubChem (NCBI)