CAS 32062-69-4 is the registry number for N–(4–Bromophenyl)–N–phenyl–Thiourea. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-(4-bromophenyl)-1-phenylthiourea (CAS 32062-69-4) is a chemical compound with the molecular formula C13H11BrN2S and a molecular weight of 307.21 g/mol. IUPAC name: 1-(4-bromophenyl)-1-phenylthiourea. InChIKey: KIFLSJISPDSBCJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2S |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1-phenylthiourea |
| InChIKey | KIFLSJISPDSBCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)Br)C(=S)N |
Computed by PubChem (NCBI)