CAS 1268954-77-3 appears in our catalog under these names: 1-(4'-Bromo-[1,1'-biphenyl]-3-yl)naphthalene, 95%, 1-(4'-Bromo-(1,1'-biphenyl)-3-yl)naphthalene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-[3-(4-bromophenyl)phenyl]naphthalene (CAS 1268954-77-3) is a chemical compound with the molecular formula C22H15Br and a molecular weight of 359.3 g/mol. IUPAC name: 1-[3-(4-bromophenyl)phenyl]naphthalene. InChIKey: AITBCZBEWHFDDB-UHFFFAOYSA-N.
| Molecular formula | C22H15Br |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 1-[3-(4-bromophenyl)phenyl]naphthalene |
| InChIKey | AITBCZBEWHFDDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=CC(=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)