CAS 861212-66-0 is the registry number for 2-(4'-Bromo-[1,1'-biphenyl]-4-yl)naphthalene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(4-bromophenyl)phenyl]naphthalene (CAS 861212-66-0) is a chemical compound with the molecular formula C22H15Br and a molecular weight of 359.3 g/mol. IUPAC name: 2-[4-(4-bromophenyl)phenyl]naphthalene. InChIKey: KWCQSYNZPAMUOW-UHFFFAOYSA-N.
| Molecular formula | C22H15Br |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)phenyl]naphthalene |
| InChIKey | KWCQSYNZPAMUOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)