CAS 1269152-27-3 is the registry number for 3-Cyclopropanecarbonyl-4,5-dimethylthiophen-2-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(2-amino-4,5-dimethylthiophen-3-yl)-cyclopropylmethanone (CAS 1269152-27-3) is a chemical compound with the molecular formula C10H13NOS and a molecular weight of 195.28 g/mol. IUPAC name: (2-amino-4,5-dimethylthiophen-3-yl)-cyclopropylmethanone. InChIKey: QGPDXKGRFGMESQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NOS |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | (2-amino-4,5-dimethylthiophen-3-yl)-cyclopropylmethanone |
| InChIKey | QGPDXKGRFGMESQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)C2CC2)N)C |
Computed by PubChem (NCBI)