CAS 1269152-28-4 appears in our catalog under these names: {1-((4-Bromophenyl)methyl)-1H-pyrazol-4-yl}methanol, {1-((4-bromophenyl)methyl)-1H-pyrazol-4-yl}methanol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
[1-[(4-bromophenyl)methyl]pyrazol-4-yl]methanol (CAS 1269152-28-4) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: [1-[(4-bromophenyl)methyl]pyrazol-4-yl]methanol. InChIKey: JPIBRLGJCCMNHR-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | [1-[(4-bromophenyl)methyl]pyrazol-4-yl]methanol |
| InChIKey | JPIBRLGJCCMNHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=N2)CO)Br |
Computed by PubChem (NCBI)