CAS 1269152-39-7 appears in our catalog under these names: 2-[(2-Chloro-6-nitrophenyl)formamido]acetic acid, 95%, 2-((2-Chloro-6-nitrophenyl)formamido)acetic acid, 95%, 2-((2-Chloro-6-nitrophenyl)formamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-[(2-chloro-6-nitrobenzoyl)amino]acetic acid (CAS 1269152-39-7) is a chemical compound with the molecular formula C9H7ClN2O5 and a molecular weight of 258.61 g/mol. IUPAC name: 2-[(2-chloro-6-nitrobenzoyl)amino]acetic acid. InChIKey: DDSUIEKXBYCNFR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O5 |
|---|---|
| Molecular weight | 258.61 g/mol |
| IUPAC name | 2-[(2-chloro-6-nitrobenzoyl)amino]acetic acid |
| InChIKey | DDSUIEKXBYCNFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)