Products 949873-89-6
CAS 949873-89-6 appears in our catalog under these names: 4-[(Chloroacetyl)amino]-3-nitrobenzoic acid, 95%, 4-(2-Chloroacetamido)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(2-chloroacetyl)amino]-3-nitrobenzoic acid (CAS 949873-89-6) is a chemical compound with the molecular formula C9H7ClN2O5 and a molecular weight of 258.61 g/mol. IUPAC name: 4-[(2-chloroacetyl)amino]-3-nitrobenzoic acid. InChIKey: LIJBLHADASRVHV-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O5 |
|---|---|
| Molecular weight | 258.61 g/mol |
| IUPAC name | 4-[(2-chloroacetyl)amino]-3-nitrobenzoic acid |
| InChIKey | LIJBLHADASRVHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])NC(=O)CCl |
Computed by PubChem (NCBI)