CAS 1269225-38-8 appears in our catalog under these names: N1,N1-Dimethyl-2-(trifluoromethyl)-1,4-benzenediamine dihydrochloride, 95%, N~1~,N~1~-dimethyl-2-(trifluoromethyl)-1,4-benzenediamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;dihydrochloride (CAS 1269225-38-8) is a chemical compound with the molecular formula C9H13Cl2F3N2 and a molecular weight of 277.11 g/mol. IUPAC name: 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;dihydrochloride. InChIKey: IJSWZLZBWAXWMB-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2F3N2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;dihydrochloride |
| InChIKey | IJSWZLZBWAXWMB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)