CAS 1965309-13-0 is the registry number for N1,N1-Dimethyl-6-(trifluoromethyl)benzene-1,3-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride (CAS 1965309-13-0) is a chemical compound with the molecular formula C9H13Cl2F3N2 and a molecular weight of 277.11 g/mol. IUPAC name: 3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride. InChIKey: ADOSXDXMLNSSLG-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2F3N2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride |
| InChIKey | ADOSXDXMLNSSLG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=C1)N)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)