Products 1269292-64-9

CAS 1269292-64-9 is the registry number for 5-Bromo-2-iodo-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-iodo-4-methoxybenzoic acid (CAS 1269292-64-9) is a chemical compound with the molecular formula C8H6BrIO3 and a molecular weight of 356.94 g/mol. IUPAC name: 5-bromo-2-iodo-4-methoxybenzoic acid. InChIKey: NYCLPOHLHGQJDV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrIO3
Molecular weight356.94 g/mol
IUPAC name5-bromo-2-iodo-4-methoxybenzoic acid
InChIKeyNYCLPOHLHGQJDV-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)I)C(=O)O)Br

Computed by PubChem (NCBI)