CAS 18071-51-7 appears in our catalog under these names: Methyl 5-bromo-2-hydroxy-3-iodobenzoate, 95%, Methyl 5-bromo-2-hydroxy-3-iodobenzenecarboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
Methyl 5-bromo-2-hydroxy-3-iodobenzoate (CAS 18071-51-7) is a chemical compound with the molecular formula C8H6BrIO3 and a molecular weight of 356.94 g/mol. IUPAC name: methyl 5-bromo-2-hydroxy-3-iodobenzoate. InChIKey: VSSVFOUMITYFEN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO3 |
|---|---|
| Molecular weight | 356.94 g/mol |
| IUPAC name | methyl 5-bromo-2-hydroxy-3-iodobenzoate |
| InChIKey | VSSVFOUMITYFEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)I)O |
Computed by PubChem (NCBI)