CAS 1269449-25-3 appears in our catalog under these names: 2,4-Dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine hydrochloride, 95%, 2,4–Dichloro–6,7,8,9–tetrahydro–5H–pyrimido(4,5–d)azepine hydrochloride. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg.
2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;hydrochloride (CAS 1269449-25-3) is a chemical compound with the molecular formula C8H10Cl3N3 and a molecular weight of 254.5 g/mol. IUPAC name: 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;hydrochloride. InChIKey: QGMCYSHMDAGGJU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N3 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;hydrochloride |
| InChIKey | QGMCYSHMDAGGJU-UHFFFAOYSA-N |
| SMILES | C1CNCCC2=C1C(=NC(=N2)Cl)Cl.Cl |
Computed by PubChem (NCBI)