CAS 2138151-02-5 is the registry number for (3-Chloroimidazo(1,2-a)pyridin-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-chloroimidazo[1,2-a]pyridin-2-yl)methanamine;dihydrochloride (CAS 2138151-02-5) is a chemical compound with the molecular formula C8H10Cl3N3 and a molecular weight of 254.5 g/mol. IUPAC name: (3-chloroimidazo[1,2-a]pyridin-2-yl)methanamine;dihydrochloride. InChIKey: XTMKJGHXSFCLIJ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N3 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | (3-chloroimidazo[1,2-a]pyridin-2-yl)methanamine;dihydrochloride |
| InChIKey | XTMKJGHXSFCLIJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)Cl)CN.Cl.Cl |
Computed by PubChem (NCBI)