Products 1269503-17-4

CAS 1269503-17-4 is the registry number for 2-Amino-5-(4-bromo-phenyl)-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1269503-17-4) is a chemical compound with the molecular formula C10H7BrN2O2S and a molecular weight of 299.15 g/mol. IUPAC name: 2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: ISDYGMSNWUGLAA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7BrN2O2S
Molecular weight299.15 g/mol
IUPAC name2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyISDYGMSNWUGLAA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(N=C(S2)N)C(=O)O)Br

Computed by PubChem (NCBI)