CAS 942920-44-7 is the registry number for 5-Bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.
5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole (CAS 942920-44-7) is a chemical compound with the molecular formula C10H7BrN2O2S and a molecular weight of 299.15 g/mol. IUPAC name: 5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole. InChIKey: LMJUXYQCUREBHV-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2S |
|---|---|
| Molecular weight | 299.15 g/mol |
| IUPAC name | 5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole |
| InChIKey | LMJUXYQCUREBHV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)Br)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)