Products 942920-44-7

CAS 942920-44-7 is the registry number for 5-Bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.

Structural formula: {0} (CAS {1})

5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole (CAS 942920-44-7) is a chemical compound with the molecular formula C10H7BrN2O2S and a molecular weight of 299.15 g/mol. IUPAC name: 5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole. InChIKey: LMJUXYQCUREBHV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7BrN2O2S
Molecular weight299.15 g/mol
IUPAC name5-bromo-2-methyl-4-(4-nitrophenyl)-1,3-thiazole
InChIKeyLMJUXYQCUREBHV-UHFFFAOYSA-N
SMILESCC1=NC(=C(S1)Br)C2=CC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)