CAS 1269755-02-3 appears in our catalog under these names: [N(E),S(S)]-2-Methyl-N-[(tetrahydro-2H-pyran-4-yl)methylene]-2-propanesulfinamide, 95%, 95%, (S,E)-2-METHYL-N-((TETRAHYDRO-2H-PYRAN-4-YL)METHYLENE)PROPANE-2-SULFINAMIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(S)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide (CAS 1269755-02-3) is a chemical compound with the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. IUPAC name: (S)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide. InChIKey: ISEYRWAHITWIMU-AWEZNQCLSA-N.
| Molecular formula | C10H19NO2S |
|---|---|
| Molecular weight | 217.33 g/mol |
| IUPAC name | (S)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide |
| InChIKey | ISEYRWAHITWIMU-AWEZNQCLSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1CCOCC1 |
Computed by PubChem (NCBI)