Products 1269963-15-6
CAS 1269963-15-6 is the registry number for (S)-1-(3-Chloro-4-(trifluoromethoxy)phenyl)but-3-en-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-en-1-amine (CAS 1269963-15-6) is a chemical compound with the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. IUPAC name: (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-en-1-amine. InChIKey: GBMPMKYYFIFFER-VIFPVBQESA-N.
| Molecular formula | C11H11ClF3NO |
|---|---|
| Molecular weight | 265.66 g/mol |
| IUPAC name | (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-en-1-amine |
| InChIKey | GBMPMKYYFIFFER-VIFPVBQESA-N |
| SMILES | C=CC[C@@H](C1=CC(=C(C=C1)OC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)