CAS 853574-45-5 is the registry number for N-Benzyl-2-chloro-N-(2,2,2-trifluoroethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)acetamide (CAS 853574-45-5) is a chemical compound with the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. IUPAC name: N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: IBUXFBXIJTWNTC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO |
|---|---|
| Molecular weight | 265.66 g/mol |
| IUPAC name | N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | IBUXFBXIJTWNTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC(F)(F)F)C(=O)CCl |
Computed by PubChem (NCBI)