CAS 1269984-07-7 is the registry number for (R)-1-(3,5-Dibromophenyl)-2-methoxyethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,5-dibromophenyl)-2-methoxyethanamine (CAS 1269984-07-7) is a chemical compound with the molecular formula C9H11Br2NO and a molecular weight of 309.00 g/mol. IUPAC name: (1R)-1-(3,5-dibromophenyl)-2-methoxyethanamine. InChIKey: FUXRKFXMBZYQNC-VIFPVBQESA-N.
| Molecular formula | C9H11Br2NO |
|---|---|
| Molecular weight | 309.00 g/mol |
| IUPAC name | (1R)-1-(3,5-dibromophenyl)-2-methoxyethanamine |
| InChIKey | FUXRKFXMBZYQNC-VIFPVBQESA-N |
| SMILES | COC[C@@H](C1=CC(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)