CAS 1803611-14-4 appears in our catalog under these names: 2,4-Dibromo-6-(2-methoxyethyl)aniline, 95%, 2,4-Dibromo-6-(2-methoxyethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dibromo-6-(2-methoxyethyl)aniline (CAS 1803611-14-4) is a chemical compound with the molecular formula C9H11Br2NO and a molecular weight of 309.00 g/mol. IUPAC name: 2,4-dibromo-6-(2-methoxyethyl)aniline. InChIKey: SWLGYBAQLZOOFJ-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2NO |
|---|---|
| Molecular weight | 309.00 g/mol |
| IUPAC name | 2,4-dibromo-6-(2-methoxyethyl)aniline |
| InChIKey | SWLGYBAQLZOOFJ-UHFFFAOYSA-N |
| SMILES | COCCC1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)