Products 1270132-45-0
CAS 1270132-45-0 appears in our catalog under these names: Lifitegrast Impurity 34, (R)-2-Amino-3-(3-(methylsulfonyl)phenyl)propanoic acid, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g, 250mg.
(2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid (CAS 1270132-45-0) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid. InChIKey: QKZNLZTVEVNSPE-SECBINFHSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid |
| InChIKey | QKZNLZTVEVNSPE-SECBINFHSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)