CAS 1270183-23-7 is the registry number for (S)-1-(3,4-Difluorophenyl)-2-methoxyethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,4-difluorophenyl)-2-methoxyethanamine (CAS 1270183-23-7) is a chemical compound with the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. IUPAC name: (1S)-1-(3,4-difluorophenyl)-2-methoxyethanamine. InChIKey: HMXDXOIJHPACRX-SECBINFHSA-N.
| Molecular formula | C9H11F2NO |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (1S)-1-(3,4-difluorophenyl)-2-methoxyethanamine |
| InChIKey | HMXDXOIJHPACRX-SECBINFHSA-N |
| SMILES | COC[C@H](C1=CC(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)