CAS 1270290-64-6 appears in our catalog under these names: Fmoc-D-Phe(2,3-DiMe)-OH 95%, (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,3-dimethylphenyl)propanoic acid, ≥98%, ≥98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2R)-3-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1270290-64-6) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2R)-3-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DGFWPHOIYSZHRN-XMMPIXPASA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2R)-3-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DGFWPHOIYSZHRN-XMMPIXPASA-N |
| SMILES | CC1=C(C(=CC=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)