CAS 1270306-61-0 is the registry number for 5-(5-Bromo-2-fluorophenyl) Proline. Offered by: TRC. Available pack sizes: 250mg.
(2S)-5-(5-bromo-2-fluorophenyl)pyrrolidine-2-carboxylic acid (CAS 1270306-61-0) is a chemical compound with the molecular formula C11H11BrFNO2 and a molecular weight of 288.11 g/mol. IUPAC name: (2S)-5-(5-bromo-2-fluorophenyl)pyrrolidine-2-carboxylic acid. InChIKey: JXGMYSJDXPRRNL-AXDSSHIGSA-N.
| Molecular formula | C11H11BrFNO2 |
|---|---|
| Molecular weight | 288.11 g/mol |
| IUPAC name | (2S)-5-(5-bromo-2-fluorophenyl)pyrrolidine-2-carboxylic acid |
| InChIKey | JXGMYSJDXPRRNL-AXDSSHIGSA-N |
| SMILES | C1CC(N[C@@H]1C(=O)O)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)