Products 1620318-89-9
CAS 1620318-89-9 is the registry number for Ethyl 1-(5-bromo-3-fluoropyridin-2-yl)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 1-(5-bromo-3-fluoro-2-pyridinyl)cyclopropane-1-carboxylate (CAS 1620318-89-9) is a chemical compound with the molecular formula C11H11BrFNO2 and a molecular weight of 288.11 g/mol. IUPAC name: ethyl 1-(5-bromo-3-fluoro-2-pyridinyl)cyclopropane-1-carboxylate. InChIKey: FULNPMZQBWMBDC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrFNO2 |
|---|---|
| Molecular weight | 288.11 g/mol |
| IUPAC name | ethyl 1-(5-bromo-3-fluoro-2-pyridinyl)cyclopropane-1-carboxylate |
| InChIKey | FULNPMZQBWMBDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)C2=C(C=C(C=N2)Br)F |
Computed by PubChem (NCBI)