Products 1270501-44-4
CAS 1270501-44-4 is the registry number for 3-Amino-3-(6-amino-2-methylpyridin-3-yl)propanenitrile, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
3-amino-3-(6-amino-2-methyl-3-pyridinyl)propanenitrile (CAS 1270501-44-4) is a chemical compound with the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. IUPAC name: 3-amino-3-(6-amino-2-methyl-3-pyridinyl)propanenitrile. InChIKey: ZBGFAFVYMXNUMS-UHFFFAOYSA-N.
| Molecular formula | C9H12N4 |
|---|---|
| Molecular weight | 176.22 g/mol |
| IUPAC name | 3-amino-3-(6-amino-2-methyl-3-pyridinyl)propanenitrile |
| InChIKey | ZBGFAFVYMXNUMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)N)C(CC#N)N |
Computed by PubChem (NCBI)